C13H7BrCl2N2O — CID 107658072
3-[(4-bromo-2,5-dichlorophenoxy)methyl]pyridine-2-carbonitrile (PubChem CID 107658072) has the molecular formula C13H7BrCl2N2O and a molecular weight of 358.02 g/mol. Its IUPAC name is 3-[(4-bromo-2,5-dichlorophenoxy)methyl]pyridine-2-carbonitrile.
| Compound Name | 3-[(4-bromo-2,5-dichlorophenoxy)methyl]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 107658072 |
| Molecular Formula | C13H7BrCl2N2O |
| Molecular Weight | 358.02 g/mol |
| Exact Mass | 355.91 |
| IUPAC Name | 3-[(4-bromo-2,5-dichlorophenoxy)methyl]pyridine-2-carbonitrile |
| SMILES | N#Cc1ncccc1COc1cc(Cl)c(Br)cc1Cl |
| InChI | InChI=1S/C13H7BrCl2N2O/c14-9-4-11(16)13(5-10(9)15)19-7-8-2-1-3-18-12(8)6-17/h1-5H,7H2 |
| InChIKey | CFARGYZXGBQVSO-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 45.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.02 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|