C13H10Br2N2O3 — CID 114308438
3-[(2,6-dibromo-4-nitrophenoxy)methyl]aniline (PubChem CID 114308438) has the molecular formula C13H10Br2N2O3 and a molecular weight of 402.04 g/mol. Its IUPAC name is 3-[(2,6-dibromo-4-nitrophenoxy)methyl]aniline.
| Compound Name | 3-[(2,6-dibromo-4-nitrophenoxy)methyl]aniline |
|---|---|
| PubChem CID | 114308438 |
| Molecular Formula | C13H10Br2N2O3 |
| Molecular Weight | 402.04 g/mol |
| Exact Mass | 399.91 |
| IUPAC Name | 3-[(2,6-dibromo-4-nitrophenoxy)methyl]aniline |
| SMILES | Nc1cccc(COc2c(Br)cc([N+](=O)[O-])cc2Br)c1 |
| InChI | InChI=1S/C13H10Br2N2O3/c14-11-5-10(17(18)19)6-12(15)13(11)20-7-8-2-1-3-9(16)4-8/h1-6H,7,16H2 |
| InChIKey | QDVRMOHNGZYVON-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 78.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.04 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|