C29H30N8O5 — CID 158441880
3-[(3-aminophenyl)methoxy]pyridin-2-amine;2-aminopyridin-3-ol;3-[(3-nitrophenyl)methoxy]pyridin-2-amine (PubChem CID 158441880) has the molecular formula C29H30N8O5 and a molecular weight of 570.61 g/mol. Its IUPAC name is 3-[(3-aminophenyl)methoxy]pyridin-2-amine;2-aminopyridin-3-ol;3-[(3-nitrophenyl)methoxy]pyridin-2-amine.
| Compound Name | 3-[(3-aminophenyl)methoxy]pyridin-2-amine;2-aminopyridin-3-ol;3-[(3-nitrophenyl)methoxy]pyridin-2-amine |
|---|---|
| PubChem CID | 158441880 |
| Molecular Formula | C29H30N8O5 |
| Molecular Weight | 570.61 g/mol |
| Exact Mass | 570.23 |
| IUPAC Name | 3-[(3-aminophenyl)methoxy]pyridin-2-amine;2-aminopyridin-3-ol;3-[(3-nitrophenyl)methoxy]pyridin-2-amine |
| SMILES | Nc1cccc(COc2cccnc2N)c1.Nc1ncccc1O.Nc1ncccc1OCc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H11N3O3.C12H13N3O.C5H6N2O/c13-12-11(5-2-6-14-12)18-8-9-3-1-4-10(7-9)15(16)17;13-10-4-1-3-9(7-10)8-16-11-5-2-6-15-12(11)14;6-5-4(8)2-1-3-7-5/h1-7H,8H2,(H2,13,14);1-7H,8,13H2,(H2,14,15);1-3,8H,(H2,6,7) |
| InChIKey | HCXOQIKOJJNJDS-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 224.58 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.61 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_OC_no_alk_C(3)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|