C15H9Br2N3O4 — CID 2397376
2-[(2,6-dibromo-4-nitrophenoxy)methyl]-5-phenyl-1,3,4-oxadiazole (PubChem CID 2397376) has the molecular formula C15H9Br2N3O4 and a molecular weight of 455.06 g/mol. Its IUPAC name is 2-[(2,6-dibromo-4-nitrophenoxy)methyl]-5-phenyl-1,3,4-oxadiazole.
| Compound Name | 2-[(2,6-dibromo-4-nitrophenoxy)methyl]-5-phenyl-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 2397376 |
| Molecular Formula | C15H9Br2N3O4 |
| Molecular Weight | 455.06 g/mol |
| Exact Mass | 452.90 |
| IUPAC Name | 2-[(2,6-dibromo-4-nitrophenoxy)methyl]-5-phenyl-1,3,4-oxadiazole |
| SMILES | O=[N+]([O-])c1cc(Br)c(OCc2nnc(-c3ccccc3)o2)c(Br)c1 |
| InChI | InChI=1S/C15H9Br2N3O4/c16-11-6-10(20(21)22)7-12(17)14(11)23-8-13-18-19-15(24-13)9-4-2-1-3-5-9/h1-7H,8H2 |
| InChIKey | MNEYIZPSDCZPRS-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 91.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.06 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|