C16H13N3O5 — CID 7680960
2-[(4-methoxy-2-nitrophenoxy)methyl]-5-phenyl-1,3,4-oxadiazole (PubChem CID 7680960) has the molecular formula C16H13N3O5 and a molecular weight of 327.30 g/mol. Its IUPAC name is 2-[(4-methoxy-2-nitrophenoxy)methyl]-5-phenyl-1,3,4-oxadiazole.
| Compound Name | 2-[(4-methoxy-2-nitrophenoxy)methyl]-5-phenyl-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 7680960 |
| Molecular Formula | C16H13N3O5 |
| Molecular Weight | 327.30 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | 2-[(4-methoxy-2-nitrophenoxy)methyl]-5-phenyl-1,3,4-oxadiazole |
| SMILES | COc1ccc(OCc2nnc(-c3ccccc3)o2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H13N3O5/c1-22-12-7-8-14(13(9-12)19(20)21)23-10-15-17-18-16(24-15)11-5-3-2-4-6-11/h2-9H,10H2,1H3 |
| InChIKey | RESUVQQCHRWAHP-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 100.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.30 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|