C18H16N2O5 — CID 24666676
4-[(4-methoxy-2-nitrophenoxy)methyl]-2-(4-methylphenyl)-1,3-oxazole (PubChem CID 24666676) has the molecular formula C18H16N2O5 and a molecular weight of 340.34 g/mol. Its IUPAC name is 4-[(4-methoxy-2-nitrophenoxy)methyl]-2-(4-methylphenyl)-1,3-oxazole.
| Compound Name | 4-[(4-methoxy-2-nitrophenoxy)methyl]-2-(4-methylphenyl)-1,3-oxazole |
|---|---|
| PubChem CID | 24666676 |
| Molecular Formula | C18H16N2O5 |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | 4-[(4-methoxy-2-nitrophenoxy)methyl]-2-(4-methylphenyl)-1,3-oxazole |
| SMILES | COc1ccc(OCc2coc(-c3ccc(C)cc3)n2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H16N2O5/c1-12-3-5-13(6-4-12)18-19-14(11-25-18)10-24-17-8-7-15(23-2)9-16(17)20(21)22/h3-9,11H,10H2,1-2H3 |
| InChIKey | XBRHVALFWLPVCJ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 87.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|