C14H10ClF2NO3 — CID 79881044
5-(chloromethyl)-1,3-difluoro-2-[(3-nitrophenyl)methoxy]benzene (PubChem CID 79881044) has the molecular formula C14H10ClF2NO3 and a molecular weight of 313.69 g/mol. Its IUPAC name is 5-(chloromethyl)-1,3-difluoro-2-[(3-nitrophenyl)methoxy]benzene.
| Compound Name | 5-(chloromethyl)-1,3-difluoro-2-[(3-nitrophenyl)methoxy]benzene |
|---|---|
| PubChem CID | 79881044 |
| Molecular Formula | C14H10ClF2NO3 |
| Molecular Weight | 313.69 g/mol |
| Exact Mass | 313.03 |
| IUPAC Name | 5-(chloromethyl)-1,3-difluoro-2-[(3-nitrophenyl)methoxy]benzene |
| SMILES | O=[N+]([O-])c1cccc(COc2c(F)cc(CCl)cc2F)c1 |
| InChI | InChI=1S/C14H10ClF2NO3/c15-7-10-5-12(16)14(13(17)6-10)21-8-9-2-1-3-11(4-9)18(19)20/h1-6H,7-8H2 |
| InChIKey | FLBWOJYJRQCYIS-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.69 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|