C14H18BrCl2NO — CID 107659689
2-[(4-bromo-2,5-dichlorophenoxy)methyl]-N-tert-butylprop-2-en-1-amine (PubChem CID 107659689) has the molecular formula C14H18BrCl2NO and a molecular weight of 367.11 g/mol. Its IUPAC name is 2-[(4-bromo-2,5-dichlorophenoxy)methyl]-N-tert-butylprop-2-en-1-amine.
| Compound Name | 2-[(4-bromo-2,5-dichlorophenoxy)methyl]-N-tert-butylprop-2-en-1-amine |
|---|---|
| PubChem CID | 107659689 |
| Molecular Formula | C14H18BrCl2NO |
| Molecular Weight | 367.11 g/mol |
| Exact Mass | 364.99 |
| IUPAC Name | 2-[(4-bromo-2,5-dichlorophenoxy)methyl]-N-tert-butylprop-2-en-1-amine |
| SMILES | C=C(CNC(C)(C)C)COc1cc(Cl)c(Br)cc1Cl |
| InChI | InChI=1S/C14H18BrCl2NO/c1-9(7-18-14(2,3)4)8-19-13-6-11(16)10(15)5-12(13)17/h5-6,18H,1,7-8H2,2-4H3 |
| InChIKey | JYWNGMNHWXCEQV-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.11 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|