C12H16I3NO — CID 63551677
2-methyl-N-[2-(2,4,6-triiodophenoxy)ethyl]propan-2-amine (PubChem CID 63551677) has the molecular formula C12H16I3NO and a molecular weight of 570.98 g/mol. Its IUPAC name is 2-methyl-N-[2-(2,4,6-triiodophenoxy)ethyl]propan-2-amine.
| Compound Name | 2-methyl-N-[2-(2,4,6-triiodophenoxy)ethyl]propan-2-amine |
|---|---|
| PubChem CID | 63551677 |
| Molecular Formula | C12H16I3NO |
| Molecular Weight | 570.98 g/mol |
| Exact Mass | 570.84 |
| IUPAC Name | 2-methyl-N-[2-(2,4,6-triiodophenoxy)ethyl]propan-2-amine |
| SMILES | CC(C)(C)NCCOc1c(I)cc(I)cc1I |
| InChI | InChI=1S/C12H16I3NO/c1-12(2,3)16-4-5-17-11-9(14)6-8(13)7-10(11)15/h6-7,16H,4-5H2,1-3H3 |
| InChIKey | KIMCWOIMEARMLY-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.98 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|