C8H7I3O2 — CID 102384226
1,3,5-triiodo-2-(methoxymethoxy)benzene (PubChem CID 102384226) has the molecular formula C8H7I3O2 and a molecular weight of 515.85 g/mol. Its IUPAC name is 1,3,5-triiodo-2-(methoxymethoxy)benzene.
| Compound Name | 1,3,5-triiodo-2-(methoxymethoxy)benzene |
|---|---|
| PubChem CID | 102384226 |
| Molecular Formula | C8H7I3O2 |
| Molecular Weight | 515.85 g/mol |
| Exact Mass | 515.76 |
| IUPAC Name | 1,3,5-triiodo-2-(methoxymethoxy)benzene |
| SMILES | COCOc1c(I)cc(I)cc1I |
| InChI | InChI=1S/C8H7I3O2/c1-12-4-13-8-6(10)2-5(9)3-7(8)11/h2-3H,4H2,1H3 |
| InChIKey | VBZQDQPDXSFAFX-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.85 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|