C14H20I2O5 — CID 169045547
1-(dimethoxymethyl)-3,5-diiodo-2-[2-(2-methoxyethoxy)ethoxy]benzene (PubChem CID 169045547) has the molecular formula C14H20I2O5 and a molecular weight of 522.12 g/mol. Its IUPAC name is 1-(dimethoxymethyl)-3,5-diiodo-2-[2-(2-methoxyethoxy)ethoxy]benzene.
| Compound Name | 1-(dimethoxymethyl)-3,5-diiodo-2-[2-(2-methoxyethoxy)ethoxy]benzene |
|---|---|
| PubChem CID | 169045547 |
| Molecular Formula | C14H20I2O5 |
| Molecular Weight | 522.12 g/mol |
| Exact Mass | 521.94 |
| IUPAC Name | 1-(dimethoxymethyl)-3,5-diiodo-2-[2-(2-methoxyethoxy)ethoxy]benzene |
| SMILES | COCCOCCOc1c(I)cc(I)cc1C(OC)OC |
| InChI | InChI=1S/C14H20I2O5/c1-17-4-5-20-6-7-21-13-11(14(18-2)19-3)8-10(15)9-12(13)16/h8-9,14H,4-7H2,1-3H3 |
| InChIKey | AXNVAHYRDJOXFD-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.12 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|