C9H8ClI3O — CID 43128717
2-(3-chloropropoxy)-1,3,5-triiodobenzene (PubChem CID 43128717) has the molecular formula C9H8ClI3O and a molecular weight of 548.33 g/mol. Its IUPAC name is 2-(3-chloropropoxy)-1,3,5-triiodobenzene.
| Compound Name | 2-(3-chloropropoxy)-1,3,5-triiodobenzene |
|---|---|
| PubChem CID | 43128717 |
| Molecular Formula | C9H8ClI3O |
| Molecular Weight | 548.33 g/mol |
| Exact Mass | 547.74 |
| IUPAC Name | 2-(3-chloropropoxy)-1,3,5-triiodobenzene |
| SMILES | ClCCCOc1c(I)cc(I)cc1I |
| InChI | InChI=1S/C9H8ClI3O/c10-2-1-3-14-9-7(12)4-6(11)5-8(9)13/h4-5H,1-3H2 |
| InChIKey | XMSBHAAMEOTLEN-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.33 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|