C9H9I3N2O2 — CID 43128728
N'-hydroxy-3-(2,4,6-triiodophenoxy)propanimidamide (PubChem CID 43128728) has the molecular formula C9H9I3N2O2 and a molecular weight of 557.90 g/mol. Its IUPAC name is N'-hydroxy-3-(2,4,6-triiodophenoxy)propanimidamide.
| Compound Name | N'-hydroxy-3-(2,4,6-triiodophenoxy)propanimidamide |
|---|---|
| PubChem CID | 43128728 |
| Molecular Formula | C9H9I3N2O2 |
| Molecular Weight | 557.90 g/mol |
| Exact Mass | 557.78 |
| IUPAC Name | N'-hydroxy-3-(2,4,6-triiodophenoxy)propanimidamide |
| SMILES | N/C(CCOc1c(I)cc(I)cc1I)=N\O |
| InChI | InChI=1S/C9H9I3N2O2/c10-5-3-6(11)9(7(12)4-5)16-2-1-8(13)14-15/h3-4,15H,1-2H2,(H2,13,14) |
| InChIKey | SXBFUTJZUIEYOY-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.90 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|