C25H22I6N2O9 — CID 58957587
[2-oxo-3-[3-oxo-3-[2-(2,4,6-triiodophenoxy)ethylamino]propanoyl]oxypropyl] 3-oxo-3-[2-(2,4,6-triiodophenoxy)ethylamino]propanoate (PubChem CID 58957587) has the molecular formula C25H22I6N2O9 and a molecular weight of 1255.88 g/mol. Its IUPAC name is [2-oxo-3-[3-oxo-3-[2-(2,4,6-triiodophenoxy)ethylamino]propanoyl]oxypropyl] 3-oxo-3-[2-(2,4,6-triiodophenoxy)ethylamino]propanoate.
| Compound Name | [2-oxo-3-[3-oxo-3-[2-(2,4,6-triiodophenoxy)ethylamino]propanoyl]oxypropyl] 3-oxo-3-[2-(2,4,6-triiodophenoxy)ethylamino]propanoate |
|---|---|
| PubChem CID | 58957587 |
| Molecular Formula | C25H22I6N2O9 |
| Molecular Weight | 1255.88 g/mol |
| Exact Mass | 1255.56 |
| IUPAC Name | [2-oxo-3-[3-oxo-3-[2-(2,4,6-triiodophenoxy)ethylamino]propanoyl]oxypropyl] 3-oxo-3-[2-(2,4,6-triiodophenoxy)ethylamino]propanoate |
| SMILES | O=C(COC(=O)CC(=O)NCCOc1c(I)cc(I)cc1I)COC(=O)CC(=O)NCCOc1c(I)cc(I)cc1I |
| InChI | InChI=1S/C25H22I6N2O9/c26-13-5-16(28)24(17(29)6-13)39-3-1-32-20(35)9-22(37)41-11-15(34)12-42-23(38)10-21(36)33-2-4-40-25-18(30)7-14(27)8-19(25)31/h5-8H,1-4,9-12H2,(H,32,35)(H,33,36) |
| InChIKey | PDISTXMMFBSLPI-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 146.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 1255.88 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|