C15H10F2I3O8- — CID 162451033
2-[2-[3,5-dioxo-5-(2,4,6-triiodophenoxy)pentanoyl]oxyethoxy]-2,2-difluoroacetate (PubChem CID 162451033) has the molecular formula C15H10F2I3O8- and a molecular weight of 736.94 g/mol. Its IUPAC name is 2-[2-[3,5-dioxo-5-(2,4,6-triiodophenoxy)pentanoyl]oxyethoxy]-2,2-difluoroacetate.
| Compound Name | 2-[2-[3,5-dioxo-5-(2,4,6-triiodophenoxy)pentanoyl]oxyethoxy]-2,2-difluoroacetate |
|---|---|
| PubChem CID | 162451033 |
| Molecular Formula | C15H10F2I3O8- |
| Molecular Weight | 736.94 g/mol |
| Exact Mass | 736.75 |
| IUPAC Name | 2-[2-[3,5-dioxo-5-(2,4,6-triiodophenoxy)pentanoyl]oxyethoxy]-2,2-difluoroacetate |
| SMILES | O=C(CC(=O)OCCOC(F)(F)C(=O)[O-])CC(=O)Oc1c(I)cc(I)cc1I |
| InChI | InChI=1S/C15H11F2I3O8/c16-15(17,14(24)25)27-2-1-26-11(22)5-8(21)6-12(23)28-13-9(19)3-7(18)4-10(13)20/h3-4H,1-2,5-6H2,(H,24,25)/p-1 |
| InChIKey | LUMZWSKAZINKJP-UHFFFAOYSA-M |
| XLogP | 1.66 |
| TPSA | 119.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.94 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|