C13H12F3I2NO6S — CID 157150894
2-(trifluoromethylsulfonylamino)ethyl 3,5-diiodo-2-propanoyloxybenzoate (PubChem CID 157150894) has the molecular formula C13H12F3I2NO6S and a molecular weight of 621.11 g/mol. Its IUPAC name is 2-(trifluoromethylsulfonylamino)ethyl 3,5-diiodo-2-propanoyloxybenzoate.
| Compound Name | 2-(trifluoromethylsulfonylamino)ethyl 3,5-diiodo-2-propanoyloxybenzoate |
|---|---|
| PubChem CID | 157150894 |
| Molecular Formula | C13H12F3I2NO6S |
| Molecular Weight | 621.11 g/mol |
| Exact Mass | 620.84 |
| IUPAC Name | 2-(trifluoromethylsulfonylamino)ethyl 3,5-diiodo-2-propanoyloxybenzoate |
| SMILES | CCC(=O)Oc1c(I)cc(I)cc1C(=O)OCCNS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C13H12F3I2NO6S/c1-2-10(20)25-11-8(5-7(17)6-9(11)18)12(21)24-4-3-19-26(22,23)13(14,15)16/h5-6,19H,2-4H2,1H3 |
| InChIKey | LJTZSULBLNGYAO-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.11 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|