About 3-(2-acetamido-3,5-diiodobenzoyl)oxy-2,2-difluoropropanoate
3-(2-acetamido-3,5-diiodobenzoyl)oxy-2,2-difluoropropanoate (PubChem CID 162452270) has the molecular formula C12H8F2I2NO5-
and a molecular weight of 538.00 g/mol. Its IUPAC name is 3-(2-acetamido-3,5-diiodobenzoyl)oxy-2,2-difluoropropanoate.
Molecular Properties
| Compound Name | 3-(2-acetamido-3,5-diiodobenzoyl)oxy-2,2-difluoropropanoate |
| PubChem CID | 162452270 |
| Molecular Formula | C12H8F2I2NO5- |
| Molecular Weight | 538.00 g/mol |
| Exact Mass | 537.85 |
| IUPAC Name | 3-(2-acetamido-3,5-diiodobenzoyl)oxy-2,2-difluoropropanoate |
| SMILES | CC(=O)Nc1c(I)cc(I)cc1C(=O)OCC(F)(F)C(=O)[O-] |
| InChI | InChI=1S/C12H9F2I2NO5/c1-5(18)17-9-7(2-6(15)3-8(9)16)10(19)22-4-12(13,14)11(20)21/h2-3H,4H2,1H3,(H,17,18)(H,20,21)/p-1 |
| InChIKey | MZQGAWOFGRZQKZ-UHFFFAOYSA-M |
| XLogP | 1.40 |
| TPSA | 95.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 538.00 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-acetamido-3,5-diiodobenzoyl)oxy-2,2-difluoropropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-acetamido-3,5-diiodobenzoyl)oxy-2,2-difluoropropanoate?
The IUPAC name of 3-(2-acetamido-3,5-diiodobenzoyl)oxy-2,2-difluoropropanoate (CID 162452270) is 3-(2-acetamido-3,5-diiodobenzoyl)oxy-2,2-difluoropropanoate.
What is the SMILES notation for 3-(2-acetamido-3,5-diiodobenzoyl)oxy-2,2-difluoropropanoate?
The canonical SMILES for 3-(2-acetamido-3,5-diiodobenzoyl)oxy-2,2-difluoropropanoate is CC(=O)Nc1c(I)cc(I)cc1C(=O)OCC(F)(F)C(=O)[O-].
What is the InChIKey of 3-(2-acetamido-3,5-diiodobenzoyl)oxy-2,2-difluoropropanoate?
The InChIKey is MZQGAWOFGRZQKZ-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H9F2I2NO5/c1-5(18)17-9-7(2-6(15)3-8(9)16)10(19)22-4-12(13,14)11(20)21/h2-3H,4H2,1H3,(H,17,18)(H,20,21)/p-1.
What are the key properties of 3-(2-acetamido-3,5-diiodobenzoyl)oxy-2,2-difluoropropanoate?
3-(2-acetamido-3,5-diiodobenzoyl)oxy-2,2-difluoropropanoate has a molecular weight of 538.00 g/mol, XLogP of 1.40, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-acetamido-3,5-diiodobenzoyl)oxy-2,2-difluoropropanoate is sourced from PubChem (CID 162452270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).