C13H13F2O6- — CID 156684668
3-[4-(ethoxymethoxy)benzoyl]oxy-2,2-difluoropropanoate (PubChem CID 156684668) has the molecular formula C13H13F2O6- and a molecular weight of 303.24 g/mol. Its IUPAC name is 3-[4-(ethoxymethoxy)benzoyl]oxy-2,2-difluoropropanoate.
| Compound Name | 3-[4-(ethoxymethoxy)benzoyl]oxy-2,2-difluoropropanoate |
|---|---|
| PubChem CID | 156684668 |
| Molecular Formula | C13H13F2O6- |
| Molecular Weight | 303.24 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | 3-[4-(ethoxymethoxy)benzoyl]oxy-2,2-difluoropropanoate |
| SMILES | CCOCOc1ccc(C(=O)OCC(F)(F)C(=O)[O-])cc1 |
| InChI | InChI=1S/C13H14F2O6/c1-2-19-8-21-10-5-3-9(4-6-10)11(16)20-7-13(14,15)12(17)18/h3-6H,2,7-8H2,1H3,(H,17,18)/p-1 |
| InChIKey | YVJIWSRCGJMOQF-UHFFFAOYSA-M |
| XLogP | 0.60 |
| TPSA | 84.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.24 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|