C9H6F2IO4- — CID 162451086
2,2-difluoro-2-[(2-hydroxy-5-iodophenyl)methoxy]acetate (PubChem CID 162451086) has the molecular formula C9H6F2IO4- and a molecular weight of 343.04 g/mol. Its IUPAC name is 2,2-difluoro-2-[(2-hydroxy-5-iodophenyl)methoxy]acetate.
| Compound Name | 2,2-difluoro-2-[(2-hydroxy-5-iodophenyl)methoxy]acetate |
|---|---|
| PubChem CID | 162451086 |
| Molecular Formula | C9H6F2IO4- |
| Molecular Weight | 343.04 g/mol |
| Exact Mass | 342.93 |
| IUPAC Name | 2,2-difluoro-2-[(2-hydroxy-5-iodophenyl)methoxy]acetate |
| SMILES | O=C([O-])C(F)(F)OCc1cc(I)ccc1O |
| InChI | InChI=1S/C9H7F2IO4/c10-9(11,8(14)15)16-4-5-3-6(12)1-2-7(5)13/h1-3,13H,4H2,(H,14,15)/p-1 |
| InChIKey | UPPATVZNPCEOJQ-UHFFFAOYSA-M |
| XLogP | 0.86 |
| TPSA | 69.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.04 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|