C10H9F3INO2 — CID 103713631
2-hydroxy-5-iodo-N-(3,3,3-trifluoropropyl)benzamide (PubChem CID 103713631) has the molecular formula C10H9F3INO2 and a molecular weight of 359.09 g/mol. Its IUPAC name is 2-hydroxy-5-iodo-N-(3,3,3-trifluoropropyl)benzamide.
| Compound Name | 2-hydroxy-5-iodo-N-(3,3,3-trifluoropropyl)benzamide |
|---|---|
| PubChem CID | 103713631 |
| Molecular Formula | C10H9F3INO2 |
| Molecular Weight | 359.09 g/mol |
| Exact Mass | 358.96 |
| IUPAC Name | 2-hydroxy-5-iodo-N-(3,3,3-trifluoropropyl)benzamide |
| SMILES | O=C(NCCC(F)(F)F)c1cc(I)ccc1O |
| InChI | InChI=1S/C10H9F3INO2/c11-10(12,13)3-4-15-9(17)7-5-6(14)1-2-8(7)16/h1-2,5,16H,3-4H2,(H,15,17) |
| InChIKey | DABONJCLNKSXRA-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.09 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|