C11H11F3INO2 — CID 113246125
2-hydroxy-5-iodo-N-(4,4,4-trifluorobutyl)benzamide (PubChem CID 113246125) has the molecular formula C11H11F3INO2 and a molecular weight of 373.11 g/mol. Its IUPAC name is 2-hydroxy-5-iodo-N-(4,4,4-trifluorobutyl)benzamide.
| Compound Name | 2-hydroxy-5-iodo-N-(4,4,4-trifluorobutyl)benzamide |
|---|---|
| PubChem CID | 113246125 |
| Molecular Formula | C11H11F3INO2 |
| Molecular Weight | 373.11 g/mol |
| Exact Mass | 372.98 |
| IUPAC Name | 2-hydroxy-5-iodo-N-(4,4,4-trifluorobutyl)benzamide |
| SMILES | O=C(NCCCC(F)(F)F)c1cc(I)ccc1O |
| InChI | InChI=1S/C11H11F3INO2/c12-11(13,14)4-1-5-16-10(18)8-6-7(15)2-3-9(8)17/h2-3,6,17H,1,4-5H2,(H,16,18) |
| InChIKey | KROWNROZHAFOQV-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.11 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|