C10H5F3I3O3- — CID 162452188
3,3,3-trifluoro-2-[(2,4,6-triiodophenoxy)methyl]propanoate (PubChem CID 162452188) has the molecular formula C10H5F3I3O3- and a molecular weight of 610.85 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-[(2,4,6-triiodophenoxy)methyl]propanoate.
| Compound Name | 3,3,3-trifluoro-2-[(2,4,6-triiodophenoxy)methyl]propanoate |
|---|---|
| PubChem CID | 162452188 |
| Molecular Formula | C10H5F3I3O3- |
| Molecular Weight | 610.85 g/mol |
| Exact Mass | 610.73 |
| IUPAC Name | 3,3,3-trifluoro-2-[(2,4,6-triiodophenoxy)methyl]propanoate |
| SMILES | O=C([O-])C(COc1c(I)cc(I)cc1I)C(F)(F)F |
| InChI | InChI=1S/C10H6F3I3O3/c11-10(12,13)5(9(17)18)3-19-8-6(15)1-4(14)2-7(8)16/h1-2,5H,3H2,(H,17,18)/p-1 |
| InChIKey | UFFUGBGDDKJFBG-UHFFFAOYSA-M |
| XLogP | 2.81 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.85 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|