About 2-[2-(2,4,6-triiodophenoxy)acetyl]oxyethanesulfonate
2-[2-(2,4,6-triiodophenoxy)acetyl]oxyethanesulfonate (PubChem CID 153471819) has the molecular formula C10H8I3O6S-
and a molecular weight of 636.95 g/mol. Its IUPAC name is 2-[2-(2,4,6-triiodophenoxy)acetyl]oxyethanesulfonate.
Molecular Properties
| Compound Name | 2-[2-(2,4,6-triiodophenoxy)acetyl]oxyethanesulfonate |
| PubChem CID | 153471819 |
| Molecular Formula | C10H8I3O6S- |
| Molecular Weight | 636.95 g/mol |
| Exact Mass | 636.72 |
| IUPAC Name | 2-[2-(2,4,6-triiodophenoxy)acetyl]oxyethanesulfonate |
| SMILES | O=C(COc1c(I)cc(I)cc1I)OCCS(=O)(=O)[O-] |
| InChI | InChI=1S/C10H9I3O6S/c11-6-3-7(12)10(8(13)4-6)19-5-9(14)18-1-2-20(15,16)17/h3-4H,1-2,5H2,(H,15,16,17)/p-1 |
| InChIKey | YPHSKZCDYUBTIY-UHFFFAOYSA-M |
| XLogP | 1.97 |
| TPSA | 92.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 636.95 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(2,4,6-triiodophenoxy)acetyl]oxyethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(2,4,6-triiodophenoxy)acetyl]oxyethanesulfonate?
The IUPAC name of 2-[2-(2,4,6-triiodophenoxy)acetyl]oxyethanesulfonate (CID 153471819) is 2-[2-(2,4,6-triiodophenoxy)acetyl]oxyethanesulfonate.
What is the SMILES notation for 2-[2-(2,4,6-triiodophenoxy)acetyl]oxyethanesulfonate?
The canonical SMILES for 2-[2-(2,4,6-triiodophenoxy)acetyl]oxyethanesulfonate is O=C(COc1c(I)cc(I)cc1I)OCCS(=O)(=O)[O-].
What is the InChIKey of 2-[2-(2,4,6-triiodophenoxy)acetyl]oxyethanesulfonate?
The InChIKey is YPHSKZCDYUBTIY-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H9I3O6S/c11-6-3-7(12)10(8(13)4-6)19-5-9(14)18-1-2-20(15,16)17/h3-4H,1-2,5H2,(H,15,16,17)/p-1.
What are the key properties of 2-[2-(2,4,6-triiodophenoxy)acetyl]oxyethanesulfonate?
2-[2-(2,4,6-triiodophenoxy)acetyl]oxyethanesulfonate has a molecular weight of 636.95 g/mol, XLogP of 1.97, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2,4,6-triiodophenoxy)acetyl]oxyethanesulfonate is sourced from PubChem (CID 153471819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).