C15H17Br2ClN2O — CID 83171916
N-[2-(5,7-dibromo-2-chloroquinolin-8-yl)oxyethyl]-2-methylpropan-2-amine (PubChem CID 83171916) has the molecular formula C15H17Br2ClN2O and a molecular weight of 436.58 g/mol. Its IUPAC name is N-[2-(5,7-dibromo-2-chloroquinolin-8-yl)oxyethyl]-2-methylpropan-2-amine.
| Compound Name | N-[2-(5,7-dibromo-2-chloroquinolin-8-yl)oxyethyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 83171916 |
| Molecular Formula | C15H17Br2ClN2O |
| Molecular Weight | 436.58 g/mol |
| Exact Mass | 433.94 |
| IUPAC Name | N-[2-(5,7-dibromo-2-chloroquinolin-8-yl)oxyethyl]-2-methylpropan-2-amine |
| SMILES | CC(C)(C)NCCOc1c(Br)cc(Br)c2ccc(Cl)nc12 |
| InChI | InChI=1S/C15H17Br2ClN2O/c1-15(2,3)19-6-7-21-14-11(17)8-10(16)9-4-5-12(18)20-13(9)14/h4-5,8,19H,6-7H2,1-3H3 |
| InChIKey | GNCUSGMZNNBOOD-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.58 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|