C14H20Br3NO — CID 63505697
N-(2-methylpropyl)-4-(2,4,6-tribromophenoxy)butan-1-amine (PubChem CID 63505697) has the molecular formula C14H20Br3NO and a molecular weight of 458.03 g/mol. Its IUPAC name is N-(2-methylpropyl)-4-(2,4,6-tribromophenoxy)butan-1-amine.
| Compound Name | N-(2-methylpropyl)-4-(2,4,6-tribromophenoxy)butan-1-amine |
|---|---|
| PubChem CID | 63505697 |
| Molecular Formula | C14H20Br3NO |
| Molecular Weight | 458.03 g/mol |
| Exact Mass | 454.91 |
| IUPAC Name | N-(2-methylpropyl)-4-(2,4,6-tribromophenoxy)butan-1-amine |
| SMILES | CC(C)CNCCCCOc1c(Br)cc(Br)cc1Br |
| InChI | InChI=1S/C14H20Br3NO/c1-10(2)9-18-5-3-4-6-19-14-12(16)7-11(15)8-13(14)17/h7-8,10,18H,3-6,9H2,1-2H3 |
| InChIKey | ZEFHWAVPGQAQGW-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.03 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|