C12H12Cl5NO — CID 55195723
N-(cyclopropylmethyl)-2-(2,3,4,5,6-pentachlorophenoxy)ethanamine (PubChem CID 55195723) has the molecular formula C12H12Cl5NO and a molecular weight of 363.50 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-2-(2,3,4,5,6-pentachlorophenoxy)ethanamine.
| Compound Name | N-(cyclopropylmethyl)-2-(2,3,4,5,6-pentachlorophenoxy)ethanamine |
|---|---|
| PubChem CID | 55195723 |
| Molecular Formula | C12H12Cl5NO |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 360.94 |
| IUPAC Name | N-(cyclopropylmethyl)-2-(2,3,4,5,6-pentachlorophenoxy)ethanamine |
| SMILES | Clc1c(Cl)c(Cl)c(OCCNCC2CC2)c(Cl)c1Cl |
| InChI | InChI=1S/C12H12Cl5NO/c13-7-8(14)10(16)12(11(17)9(7)15)19-4-3-18-5-6-1-2-6/h6,18H,1-5H2 |
| InChIKey | CHOHOMKTLVWQHB-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|