C14H19Cl2N — CID 60789647
1-cyclohexyl-N-[(3,5-dichlorophenyl)methyl]methanamine (PubChem CID 60789647) has the molecular formula C14H19Cl2N and a molecular weight of 272.22 g/mol. Its IUPAC name is 1-cyclohexyl-N-[(3,5-dichlorophenyl)methyl]methanamine.
| Compound Name | 1-cyclohexyl-N-[(3,5-dichlorophenyl)methyl]methanamine |
|---|---|
| PubChem CID | 60789647 |
| Molecular Formula | C14H19Cl2N |
| Molecular Weight | 272.22 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | 1-cyclohexyl-N-[(3,5-dichlorophenyl)methyl]methanamine |
| SMILES | Clc1cc(Cl)cc(CNCC2CCCCC2)c1 |
| InChI | InChI=1S/C14H19Cl2N/c15-13-6-12(7-14(16)8-13)10-17-9-11-4-2-1-3-5-11/h6-8,11,17H,1-5,9-10H2 |
| InChIKey | QBYKSCFSLOPPTN-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.22 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |