C14H16Cl3NO3 — CID 75424722
N-[2-(2,4,6-trichlorophenoxy)ethyl]oxane-3-carboxamide (PubChem CID 75424722) has the molecular formula C14H16Cl3NO3 and a molecular weight of 352.65 g/mol. Its IUPAC name is N-[2-(2,4,6-trichlorophenoxy)ethyl]oxane-3-carboxamide.
| Compound Name | N-[2-(2,4,6-trichlorophenoxy)ethyl]oxane-3-carboxamide |
|---|---|
| PubChem CID | 75424722 |
| Molecular Formula | C14H16Cl3NO3 |
| Molecular Weight | 352.65 g/mol |
| Exact Mass | 351.02 |
| IUPAC Name | N-[2-(2,4,6-trichlorophenoxy)ethyl]oxane-3-carboxamide |
| SMILES | O=C(NCCOc1c(Cl)cc(Cl)cc1Cl)C1CCCOC1 |
| InChI | InChI=1S/C14H16Cl3NO3/c15-10-6-11(16)13(12(17)7-10)21-5-3-18-14(19)9-2-1-4-20-8-9/h6-7,9H,1-5,8H2,(H,18,19) |
| InChIKey | LTMQBGJUWORCQW-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.65 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|