C14H17ClO4 — CID 107135869
(3-chloro-4,5-dimethoxyphenyl)-(oxan-3-yl)methanone (PubChem CID 107135869) has the molecular formula C14H17ClO4 and a molecular weight of 284.74 g/mol. Its IUPAC name is (3-chloro-4,5-dimethoxyphenyl)-(oxan-3-yl)methanone.
| Compound Name | (3-chloro-4,5-dimethoxyphenyl)-(oxan-3-yl)methanone |
|---|---|
| PubChem CID | 107135869 |
| Molecular Formula | C14H17ClO4 |
| Molecular Weight | 284.74 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | (3-chloro-4,5-dimethoxyphenyl)-(oxan-3-yl)methanone |
| SMILES | COc1cc(C(=O)C2CCCOC2)cc(Cl)c1OC |
| InChI | InChI=1S/C14H17ClO4/c1-17-12-7-10(6-11(15)14(12)18-2)13(16)9-4-3-5-19-8-9/h6-7,9H,3-5,8H2,1-2H3 |
| InChIKey | APRKCQVZODSPSV-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.74 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |