About (4-chloro-2,5-difluorophenyl)-(oxan-3-yl)methanone
(4-chloro-2,5-difluorophenyl)-(oxan-3-yl)methanone (PubChem CID 107138527) has the molecular formula C12H11ClF2O2
and a molecular weight of 260.67 g/mol. Its IUPAC name is (4-chloro-2,5-difluorophenyl)-(oxan-3-yl)methanone.
Molecular Properties
| Compound Name | (4-chloro-2,5-difluorophenyl)-(oxan-3-yl)methanone |
| PubChem CID | 107138527 |
| Molecular Formula | C12H11ClF2O2 |
| Molecular Weight | 260.67 g/mol |
| Exact Mass | 260.04 |
| IUPAC Name | (4-chloro-2,5-difluorophenyl)-(oxan-3-yl)methanone |
| SMILES | O=C(c1cc(F)c(Cl)cc1F)C1CCCOC1 |
| InChI | InChI=1S/C12H11ClF2O2/c13-9-5-10(14)8(4-11(9)15)12(16)7-2-1-3-17-6-7/h4-5,7H,1-3,6H2 |
| InChIKey | DEZQRRCWPLMBJY-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.67 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze (4-chloro-2,5-difluorophenyl)-(oxan-3-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-chloro-2,5-difluorophenyl)-(oxan-3-yl)methanone?
The IUPAC name of (4-chloro-2,5-difluorophenyl)-(oxan-3-yl)methanone (CID 107138527) is (4-chloro-2,5-difluorophenyl)-(oxan-3-yl)methanone.
What is the SMILES notation for (4-chloro-2,5-difluorophenyl)-(oxan-3-yl)methanone?
The canonical SMILES for (4-chloro-2,5-difluorophenyl)-(oxan-3-yl)methanone is O=C(c1cc(F)c(Cl)cc1F)C1CCCOC1.
What is the InChIKey of (4-chloro-2,5-difluorophenyl)-(oxan-3-yl)methanone?
The InChIKey is DEZQRRCWPLMBJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11ClF2O2/c13-9-5-10(14)8(4-11(9)15)12(16)7-2-1-3-17-6-7/h4-5,7H,1-3,6H2.
What are the key properties of (4-chloro-2,5-difluorophenyl)-(oxan-3-yl)methanone?
(4-chloro-2,5-difluorophenyl)-(oxan-3-yl)methanone has a molecular weight of 260.67 g/mol, XLogP of 3.23, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-chloro-2,5-difluorophenyl)-(oxan-3-yl)methanone is sourced from PubChem (CID 107138527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).