C12H11F3O2 — CID 103301496
oxan-4-yl-(2,4,5-trifluorophenyl)methanone (PubChem CID 103301496) has the molecular formula C12H11F3O2 and a molecular weight of 244.21 g/mol. Its IUPAC name is oxan-4-yl-(2,4,5-trifluorophenyl)methanone.
| Compound Name | oxan-4-yl-(2,4,5-trifluorophenyl)methanone |
|---|---|
| PubChem CID | 103301496 |
| Molecular Formula | C12H11F3O2 |
| Molecular Weight | 244.21 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | oxan-4-yl-(2,4,5-trifluorophenyl)methanone |
| SMILES | O=C(c1cc(F)c(F)cc1F)C1CCOCC1 |
| InChI | InChI=1S/C12H11F3O2/c13-9-6-11(15)10(14)5-8(9)12(16)7-1-3-17-4-2-7/h5-7H,1-4H2 |
| InChIKey | LCNCSGPRNVVGEH-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.21 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|