C12H12F2O2 — CID 63936069
(3,5-difluorophenyl)-(oxan-4-yl)methanone (PubChem CID 63936069) has the molecular formula C12H12F2O2 and a molecular weight of 226.22 g/mol. Its IUPAC name is (3,5-difluorophenyl)-(oxan-4-yl)methanone.
| Compound Name | (3,5-difluorophenyl)-(oxan-4-yl)methanone |
|---|---|
| PubChem CID | 63936069 |
| Molecular Formula | C12H12F2O2 |
| Molecular Weight | 226.22 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | (3,5-difluorophenyl)-(oxan-4-yl)methanone |
| SMILES | O=C(c1cc(F)cc(F)c1)C1CCOCC1 |
| InChI | InChI=1S/C12H12F2O2/c13-10-5-9(6-11(14)7-10)12(15)8-1-3-16-4-2-8/h5-8H,1-4H2 |
| InChIKey | BTIRIKFXBZPITC-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.22 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |