C12H13ClO2 — CID 65332391
(3-chlorophenyl)-(oxan-3-yl)methanone (PubChem CID 65332391) has the molecular formula C12H13ClO2 and a molecular weight of 224.69 g/mol. Its IUPAC name is (3-chlorophenyl)-(oxan-3-yl)methanone.
| Compound Name | (3-chlorophenyl)-(oxan-3-yl)methanone |
|---|---|
| PubChem CID | 65332391 |
| Molecular Formula | C12H13ClO2 |
| Molecular Weight | 224.69 g/mol |
| Exact Mass | 224.06 |
| IUPAC Name | (3-chlorophenyl)-(oxan-3-yl)methanone |
| SMILES | O=C(c1cccc(Cl)c1)C1CCCOC1 |
| InChI | InChI=1S/C12H13ClO2/c13-11-5-1-3-9(7-11)12(14)10-4-2-6-15-8-10/h1,3,5,7,10H,2,4,6,8H2 |
| InChIKey | HOJBTZHETATDHR-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.69 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |