C12H12Cl2O2 — CID 107138536
(2,6-dichlorophenyl)-(oxan-3-yl)methanone (PubChem CID 107138536) has the molecular formula C12H12Cl2O2 and a molecular weight of 259.13 g/mol. Its IUPAC name is (2,6-dichlorophenyl)-(oxan-3-yl)methanone.
| Compound Name | (2,6-dichlorophenyl)-(oxan-3-yl)methanone |
|---|---|
| PubChem CID | 107138536 |
| Molecular Formula | C12H12Cl2O2 |
| Molecular Weight | 259.13 g/mol |
| Exact Mass | 258.02 |
| IUPAC Name | (2,6-dichlorophenyl)-(oxan-3-yl)methanone |
| SMILES | O=C(c1c(Cl)cccc1Cl)C1CCCOC1 |
| InChI | InChI=1S/C12H12Cl2O2/c13-9-4-1-5-10(14)11(9)12(15)8-3-2-6-16-7-8/h1,4-5,8H,2-3,6-7H2 |
| InChIKey | AOHXGOAOBIDKDL-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.13 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |