C19H17F5O4 — CID 91376507
1-[3-methoxy-4-[4-(2,3,4,5,6-pentafluorophenoxy)butoxy]phenyl]ethanone (PubChem CID 91376507) has the molecular formula C19H17F5O4 and a molecular weight of 404.33 g/mol. Its IUPAC name is 1-[3-methoxy-4-[4-(2,3,4,5,6-pentafluorophenoxy)butoxy]phenyl]ethanone.
| Compound Name | 1-[3-methoxy-4-[4-(2,3,4,5,6-pentafluorophenoxy)butoxy]phenyl]ethanone |
|---|---|
| PubChem CID | 91376507 |
| Molecular Formula | C19H17F5O4 |
| Molecular Weight | 404.33 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | 1-[3-methoxy-4-[4-(2,3,4,5,6-pentafluorophenoxy)butoxy]phenyl]ethanone |
| SMILES | COc1cc(C(C)=O)ccc1OCCCCOc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C19H17F5O4/c1-10(25)11-5-6-12(13(9-11)26-2)27-7-3-4-8-28-19-17(23)15(21)14(20)16(22)18(19)24/h5-6,9H,3-4,7-8H2,1-2H3 |
| InChIKey | QKPJAJCRXGMZEL-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.33 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|