C19H17F5O3 — CID 91053789
1-[3-methyl-4-[4-(2,3,4,5,6-pentafluorophenoxy)butoxy]phenyl]ethanone (PubChem CID 91053789) has the molecular formula C19H17F5O3 and a molecular weight of 388.33 g/mol. Its IUPAC name is 1-[3-methyl-4-[4-(2,3,4,5,6-pentafluorophenoxy)butoxy]phenyl]ethanone.
| Compound Name | 1-[3-methyl-4-[4-(2,3,4,5,6-pentafluorophenoxy)butoxy]phenyl]ethanone |
|---|---|
| PubChem CID | 91053789 |
| Molecular Formula | C19H17F5O3 |
| Molecular Weight | 388.33 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | 1-[3-methyl-4-[4-(2,3,4,5,6-pentafluorophenoxy)butoxy]phenyl]ethanone |
| SMILES | CC(=O)c1ccc(OCCCCOc2c(F)c(F)c(F)c(F)c2F)c(C)c1 |
| InChI | InChI=1S/C19H17F5O3/c1-10-9-12(11(2)25)5-6-13(10)26-7-3-4-8-27-19-17(23)15(21)14(20)16(22)18(19)24/h5-6,9H,3-4,7-8H2,1-2H3 |
| InChIKey | PFPDARHUKIIIGA-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.33 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|