C22H26ClNO8S — CID 6434031
(E)-3-[5-chloro-2-(2-morpholin-4-ium-4-ylethoxy)phenyl]-1-(2-methoxyphenyl)prop-2-en-1-one;hydrogen sulfate (PubChem CID 6434031) has the molecular formula C22H26ClNO8S and a molecular weight of 499.97 g/mol. Its IUPAC name is (E)-3-[5-chloro-2-(2-morpholin-4-ium-4-ylethoxy)phenyl]-1-(2-methoxyphenyl)prop-2-en-1-one;hydrogen sulfate.
| Compound Name | (E)-3-[5-chloro-2-(2-morpholin-4-ium-4-ylethoxy)phenyl]-1-(2-methoxyphenyl)prop-2-en-1-one;hydrogen sulfate |
|---|---|
| PubChem CID | 6434031 |
| Molecular Formula | C22H26ClNO8S |
| Molecular Weight | 499.97 g/mol |
| Exact Mass | 499.11 |
| IUPAC Name | (E)-3-[5-chloro-2-(2-morpholin-4-ium-4-ylethoxy)phenyl]-1-(2-methoxyphenyl)prop-2-en-1-one;hydrogen sulfate |
| SMILES | COc1ccccc1C(=O)/C=C/c1cc(Cl)ccc1OCC[NH+]1CCOCC1.O=S(=O)([O-])O |
| InChI | InChI=1S/C22H24ClNO4.H2O4S/c1-26-22-5-3-2-4-19(22)20(25)8-6-17-16-18(23)7-9-21(17)28-15-12-24-10-13-27-14-11-24;1-5(2,3)4/h2-9,16H,10-15H2,1H3;(H2,1,2,3,4)/b8-6+; |
| InChIKey | ITWIZFRBRMICDE-WVLIHFOGSA-N |
| XLogP | 1.54 |
| TPSA | 126.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.97 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|