C11H11N3O3S — CID 43532405
2-[2-(1H-1,2,4-triazol-5-ylsulfanyl)ethoxy]benzoic acid (PubChem CID 43532405) has the molecular formula C11H11N3O3S and a molecular weight of 265.29 g/mol. Its IUPAC name is 2-[2-(1H-1,2,4-triazol-5-ylsulfanyl)ethoxy]benzoic acid.
| Compound Name | 2-[2-(1H-1,2,4-triazol-5-ylsulfanyl)ethoxy]benzoic acid |
|---|---|
| PubChem CID | 43532405 |
| Molecular Formula | C11H11N3O3S |
| Molecular Weight | 265.29 g/mol |
| Exact Mass | 265.05 |
| IUPAC Name | 2-[2-(1H-1,2,4-triazol-5-ylsulfanyl)ethoxy]benzoic acid |
| SMILES | O=C(O)c1ccccc1OCCSc1ncn[nH]1 |
| InChI | InChI=1S/C11H11N3O3S/c15-10(16)8-3-1-2-4-9(8)17-5-6-18-11-12-7-13-14-11/h1-4,7H,5-6H2,(H,15,16)(H,12,13,14) |
| InChIKey | GEXCTMIGRWDRAG-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.29 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|