2-[2-(1H-1,2,4-triazol-5-ylsulfanyl)ethoxy]benzoic acid

C11H11N3O3S — CID 43532405

IUPAC2-[2-(1H-1,2,4-triazol-5-ylsulfanyl)ethoxy]benzoic acid
SMILESO=C(O)c1ccccc1OCCSc1ncn[nH]1
InChIInChI=1S/C11H11N3O3S/c15-10(16)8-3-1-2-4-9(8)17-5-6-18-11-12-7-13-14-11/h1-4,7H,5-6H2,(H,15,16)(H,12,13,14)
InChIKeyGEXCTMIGRWDRAG-UHFFFAOYSA-N
MW265.29 g/mol
LogP1.67
Rot. Bonds6

About 2-[2-(1H-1,2,4-triazol-5-ylsulfanyl)ethoxy]benzoic acid

2-[2-(1H-1,2,4-triazol-5-ylsulfanyl)ethoxy]benzoic acid (PubChem CID 43532405) has the molecular formula C11H11N3O3S and a molecular weight of 265.29 g/mol. Its IUPAC name is 2-[2-(1H-1,2,4-triazol-5-ylsulfanyl)ethoxy]benzoic acid.

Molecular Properties

Compound Name2-[2-(1H-1,2,4-triazol-5-ylsulfanyl)ethoxy]benzoic acid
PubChem CID43532405
Molecular FormulaC11H11N3O3S
Molecular Weight265.29 g/mol
Exact Mass265.05
IUPAC Name2-[2-(1H-1,2,4-triazol-5-ylsulfanyl)ethoxy]benzoic acid
SMILESO=C(O)c1ccccc1OCCSc1ncn[nH]1
InChIInChI=1S/C11H11N3O3S/c15-10(16)8-3-1-2-4-9(8)17-5-6-18-11-12-7-13-14-11/h1-4,7H,5-6H2,(H,15,16)(H,12,13,14)
InChIKeyGEXCTMIGRWDRAG-UHFFFAOYSA-N
XLogP1.67
TPSA88.10 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds6
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500265.29
LogP ≤ 51.67
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 2-[2-(1H-1,2,4-triazol-5-ylsulfanyl)ethoxy]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[2-(1H-1,2,4-triazol-5-ylsulfanyl)ethoxy]benzoic acid?
The IUPAC name of 2-[2-(1H-1,2,4-triazol-5-ylsulfanyl)ethoxy]benzoic acid (CID 43532405) is 2-[2-(1H-1,2,4-triazol-5-ylsulfanyl)ethoxy]benzoic acid.
What is the SMILES notation for 2-[2-(1H-1,2,4-triazol-5-ylsulfanyl)ethoxy]benzoic acid?
The canonical SMILES for 2-[2-(1H-1,2,4-triazol-5-ylsulfanyl)ethoxy]benzoic acid is O=C(O)c1ccccc1OCCSc1ncn[nH]1.
What is the InChIKey of 2-[2-(1H-1,2,4-triazol-5-ylsulfanyl)ethoxy]benzoic acid?
The InChIKey is GEXCTMIGRWDRAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11N3O3S/c15-10(16)8-3-1-2-4-9(8)17-5-6-18-11-12-7-13-14-11/h1-4,7H,5-6H2,(H,15,16)(H,12,13,14).
What are the key properties of 2-[2-(1H-1,2,4-triazol-5-ylsulfanyl)ethoxy]benzoic acid?
2-[2-(1H-1,2,4-triazol-5-ylsulfanyl)ethoxy]benzoic acid has a molecular weight of 265.29 g/mol, XLogP of 1.67, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(1H-1,2,4-triazol-5-ylsulfanyl)ethoxy]benzoic acid is sourced from PubChem (CID 43532405), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).