C11H12N4O3S — CID 43532400
2-[2-(1-methyltetrazol-5-yl)sulfanylethoxy]benzoic acid (PubChem CID 43532400) has the molecular formula C11H12N4O3S and a molecular weight of 280.31 g/mol. Its IUPAC name is 2-[2-(1-methyltetrazol-5-yl)sulfanylethoxy]benzoic acid.
| Compound Name | 2-[2-(1-methyltetrazol-5-yl)sulfanylethoxy]benzoic acid |
|---|---|
| PubChem CID | 43532400 |
| Molecular Formula | C11H12N4O3S |
| Molecular Weight | 280.31 g/mol |
| Exact Mass | 280.06 |
| IUPAC Name | 2-[2-(1-methyltetrazol-5-yl)sulfanylethoxy]benzoic acid |
| SMILES | Cn1nnnc1SCCOc1ccccc1C(=O)O |
| InChI | InChI=1S/C11H12N4O3S/c1-15-11(12-13-14-15)19-7-6-18-9-5-3-2-4-8(9)10(16)17/h2-5H,6-7H2,1H3,(H,16,17) |
| InChIKey | ZWGKZRGEBYBINX-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.31 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|