C8H8N6O2S — CID 102973726
4-[(1-methyltetrazol-5-yl)sulfanylmethyl]pyrimidine-5-carboxylic acid (PubChem CID 102973726) has the molecular formula C8H8N6O2S and a molecular weight of 252.26 g/mol. Its IUPAC name is 4-[(1-methyltetrazol-5-yl)sulfanylmethyl]pyrimidine-5-carboxylic acid.
| Compound Name | 4-[(1-methyltetrazol-5-yl)sulfanylmethyl]pyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 102973726 |
| Molecular Formula | C8H8N6O2S |
| Molecular Weight | 252.26 g/mol |
| Exact Mass | 252.04 |
| IUPAC Name | 4-[(1-methyltetrazol-5-yl)sulfanylmethyl]pyrimidine-5-carboxylic acid |
| SMILES | Cn1nnnc1SCc1ncncc1C(=O)O |
| InChI | InChI=1S/C8H8N6O2S/c1-14-8(11-12-13-14)17-3-6-5(7(15)16)2-9-4-10-6/h2,4H,3H2,1H3,(H,15,16) |
| InChIKey | HQTFPIPBBVCGLS-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 106.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.26 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |