C14H12Cl2OS — CID 78910752
1,4-dichloro-2-(2-phenylsulfanylethoxy)benzene (PubChem CID 78910752) has the molecular formula C14H12Cl2OS and a molecular weight of 299.22 g/mol. Its IUPAC name is 1,4-dichloro-2-(2-phenylsulfanylethoxy)benzene.
| Compound Name | 1,4-dichloro-2-(2-phenylsulfanylethoxy)benzene |
|---|---|
| PubChem CID | 78910752 |
| Molecular Formula | C14H12Cl2OS |
| Molecular Weight | 299.22 g/mol |
| Exact Mass | 298.00 |
| IUPAC Name | 1,4-dichloro-2-(2-phenylsulfanylethoxy)benzene |
| SMILES | Clc1ccc(Cl)c(OCCSc2ccccc2)c1 |
| InChI | InChI=1S/C14H12Cl2OS/c15-11-6-7-13(16)14(10-11)17-8-9-18-12-4-2-1-3-5-12/h1-7,10H,8-9H2 |
| InChIKey | FGVZJOMMZCICKY-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.22 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|