C11H10Cl2N2OS2 — CID 43250190
5-[2-(2,4-dichlorophenoxy)ethylsulfanyl]-1,3-thiazol-2-amine (PubChem CID 43250190) has the molecular formula C11H10Cl2N2OS2 and a molecular weight of 321.25 g/mol. Its IUPAC name is 5-[2-(2,4-dichlorophenoxy)ethylsulfanyl]-1,3-thiazol-2-amine.
| Compound Name | 5-[2-(2,4-dichlorophenoxy)ethylsulfanyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 43250190 |
| Molecular Formula | C11H10Cl2N2OS2 |
| Molecular Weight | 321.25 g/mol |
| Exact Mass | 319.96 |
| IUPAC Name | 5-[2-(2,4-dichlorophenoxy)ethylsulfanyl]-1,3-thiazol-2-amine |
| SMILES | Nc1ncc(SCCOc2ccc(Cl)cc2Cl)s1 |
| InChI | InChI=1S/C11H10Cl2N2OS2/c12-7-1-2-9(8(13)5-7)16-3-4-17-10-6-15-11(14)18-10/h1-2,5-6H,3-4H2,(H2,14,15) |
| InChIKey | AVSNAODPHKQBCJ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.25 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|