C11H11ClN2OS — CID 79774879
5-[(2-chloro-4-methylphenoxy)methyl]-1,3-thiazol-2-amine (PubChem CID 79774879) has the molecular formula C11H11ClN2OS and a molecular weight of 254.74 g/mol. Its IUPAC name is 5-[(2-chloro-4-methylphenoxy)methyl]-1,3-thiazol-2-amine.
| Compound Name | 5-[(2-chloro-4-methylphenoxy)methyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 79774879 |
| Molecular Formula | C11H11ClN2OS |
| Molecular Weight | 254.74 g/mol |
| Exact Mass | 254.03 |
| IUPAC Name | 5-[(2-chloro-4-methylphenoxy)methyl]-1,3-thiazol-2-amine |
| SMILES | Cc1ccc(OCc2cnc(N)s2)c(Cl)c1 |
| InChI | InChI=1S/C11H11ClN2OS/c1-7-2-3-10(9(12)4-7)15-6-8-5-14-11(13)16-8/h2-5H,6H2,1H3,(H2,13,14) |
| InChIKey | UMVGSZKGMNKMQL-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.74 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |