C10H9ClN2OS — CID 102769480
2-(2-chloro-4-methylphenoxy)-1,3-thiazol-5-amine (PubChem CID 102769480) has the molecular formula C10H9ClN2OS and a molecular weight of 240.72 g/mol. Its IUPAC name is 2-(2-chloro-4-methylphenoxy)-1,3-thiazol-5-amine.
| Compound Name | 2-(2-chloro-4-methylphenoxy)-1,3-thiazol-5-amine |
|---|---|
| PubChem CID | 102769480 |
| Molecular Formula | C10H9ClN2OS |
| Molecular Weight | 240.72 g/mol |
| Exact Mass | 240.01 |
| IUPAC Name | 2-(2-chloro-4-methylphenoxy)-1,3-thiazol-5-amine |
| SMILES | Cc1ccc(Oc2ncc(N)s2)c(Cl)c1 |
| InChI | InChI=1S/C10H9ClN2OS/c1-6-2-3-8(7(11)4-6)14-10-13-5-9(12)15-10/h2-5H,12H2,1H3 |
| InChIKey | UFYWGYACGGZVJB-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.72 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |