C14H13FN4OS2 — CID 4822072
3-[2-(2-fluorophenyl)sulfanylethylsulfanyl]-5-(furan-2-yl)-1,2,4-triazol-4-amine (PubChem CID 4822072) has the molecular formula C14H13FN4OS2 and a molecular weight of 336.42 g/mol. Its IUPAC name is 3-[2-(2-fluorophenyl)sulfanylethylsulfanyl]-5-(furan-2-yl)-1,2,4-triazol-4-amine.
| Compound Name | 3-[2-(2-fluorophenyl)sulfanylethylsulfanyl]-5-(furan-2-yl)-1,2,4-triazol-4-amine |
|---|---|
| PubChem CID | 4822072 |
| Molecular Formula | C14H13FN4OS2 |
| Molecular Weight | 336.42 g/mol |
| Exact Mass | 336.05 |
| IUPAC Name | 3-[2-(2-fluorophenyl)sulfanylethylsulfanyl]-5-(furan-2-yl)-1,2,4-triazol-4-amine |
| SMILES | Nn1c(SCCSc2ccccc2F)nnc1-c1ccco1 |
| InChI | InChI=1S/C14H13FN4OS2/c15-10-4-1-2-6-12(10)21-8-9-22-14-18-17-13(19(14)16)11-5-3-7-20-11/h1-7H,8-9,16H2 |
| InChIKey | IXROGTUTBMTSFY-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 69.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.42 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|