C16H15BrN4O2S — CID 7638166
4-[[4-amino-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]-1-(4-bromophenyl)butan-1-one (PubChem CID 7638166) has the molecular formula C16H15BrN4O2S and a molecular weight of 407.29 g/mol. Its IUPAC name is 4-[[4-amino-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]-1-(4-bromophenyl)butan-1-one.
| Compound Name | 4-[[4-amino-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]-1-(4-bromophenyl)butan-1-one |
|---|---|
| PubChem CID | 7638166 |
| Molecular Formula | C16H15BrN4O2S |
| Molecular Weight | 407.29 g/mol |
| Exact Mass | 406.01 |
| IUPAC Name | 4-[[4-amino-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]-1-(4-bromophenyl)butan-1-one |
| SMILES | Nn1c(SCCCC(=O)c2ccc(Br)cc2)nnc1-c1ccco1 |
| InChI | InChI=1S/C16H15BrN4O2S/c17-12-7-5-11(6-8-12)13(22)3-2-10-24-16-20-19-15(21(16)18)14-4-1-9-23-14/h1,4-9H,2-3,10,18H2 |
| InChIKey | GTPWIHOPIMJEFR-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 86.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.29 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|