C20H19BrN4OS — CID 112784279
1-(4-bromophenyl)-4-[(4-prop-2-enyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]butan-1-one (PubChem CID 112784279) has the molecular formula C20H19BrN4OS and a molecular weight of 443.37 g/mol. Its IUPAC name is 1-(4-bromophenyl)-4-[(4-prop-2-enyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]butan-1-one.
| Compound Name | 1-(4-bromophenyl)-4-[(4-prop-2-enyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]butan-1-one |
|---|---|
| PubChem CID | 112784279 |
| Molecular Formula | C20H19BrN4OS |
| Molecular Weight | 443.37 g/mol |
| Exact Mass | 442.05 |
| IUPAC Name | 1-(4-bromophenyl)-4-[(4-prop-2-enyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]butan-1-one |
| SMILES | C=CCn1c(SCCCC(=O)c2ccc(Br)cc2)nnc1-c1ccncc1 |
| InChI | InChI=1S/C20H19BrN4OS/c1-2-13-25-19(16-9-11-22-12-10-16)23-24-20(25)27-14-3-4-18(26)15-5-7-17(21)8-6-15/h2,5-12H,1,3-4,13-14H2 |
| InChIKey | CAPCULYHPPNOKH-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.37 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|