C24H21FN4OS — CID 18229403
4-[(4-benzyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]-1-(4-fluorophenyl)butan-1-one (PubChem CID 18229403) has the molecular formula C24H21FN4OS and a molecular weight of 432.52 g/mol. Its IUPAC name is 4-[(4-benzyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]-1-(4-fluorophenyl)butan-1-one.
| Compound Name | 4-[(4-benzyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]-1-(4-fluorophenyl)butan-1-one |
|---|---|
| PubChem CID | 18229403 |
| Molecular Formula | C24H21FN4OS |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | 4-[(4-benzyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]-1-(4-fluorophenyl)butan-1-one |
| SMILES | O=C(CCCSc1nnc(-c2ccncc2)n1Cc1ccccc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C24H21FN4OS/c25-21-10-8-19(9-11-21)22(30)7-4-16-31-24-28-27-23(20-12-14-26-15-13-20)29(24)17-18-5-2-1-3-6-18/h1-3,5-6,8-15H,4,7,16-17H2 |
| InChIKey | LACCMIITPOPRQY-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|