C26H23N3O3S — CID 2564476
4-[[4-(1,3-benzodioxol-5-ylmethyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]-1-phenylbutan-1-one (PubChem CID 2564476) has the molecular formula C26H23N3O3S and a molecular weight of 457.56 g/mol. Its IUPAC name is 4-[[4-(1,3-benzodioxol-5-ylmethyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]-1-phenylbutan-1-one.
| Compound Name | 4-[[4-(1,3-benzodioxol-5-ylmethyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]-1-phenylbutan-1-one |
|---|---|
| PubChem CID | 2564476 |
| Molecular Formula | C26H23N3O3S |
| Molecular Weight | 457.56 g/mol |
| Exact Mass | 457.15 |
| IUPAC Name | 4-[[4-(1,3-benzodioxol-5-ylmethyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]-1-phenylbutan-1-one |
| SMILES | O=C(CCCSc1nnc(-c2ccccc2)n1Cc1ccc2c(c1)OCO2)c1ccccc1 |
| InChI | InChI=1S/C26H23N3O3S/c30-22(20-8-3-1-4-9-20)12-7-15-33-26-28-27-25(21-10-5-2-6-11-21)29(26)17-19-13-14-23-24(16-19)32-18-31-23/h1-6,8-11,13-14,16H,7,12,15,17-18H2 |
| InChIKey | JUBZUQQTLOITKA-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 66.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.56 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|