C19H19N3O3S — CID 27908764
4-(1,3-benzodioxol-5-ylmethyl)-3-(2-methoxyethylsulfanyl)-5-phenyl-1,2,4-triazole (PubChem CID 27908764) has the molecular formula C19H19N3O3S and a molecular weight of 369.45 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-ylmethyl)-3-(2-methoxyethylsulfanyl)-5-phenyl-1,2,4-triazole.
| Compound Name | 4-(1,3-benzodioxol-5-ylmethyl)-3-(2-methoxyethylsulfanyl)-5-phenyl-1,2,4-triazole |
|---|---|
| PubChem CID | 27908764 |
| Molecular Formula | C19H19N3O3S |
| Molecular Weight | 369.45 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | 4-(1,3-benzodioxol-5-ylmethyl)-3-(2-methoxyethylsulfanyl)-5-phenyl-1,2,4-triazole |
| SMILES | COCCSc1nnc(-c2ccccc2)n1Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H19N3O3S/c1-23-9-10-26-19-21-20-18(15-5-3-2-4-6-15)22(19)12-14-7-8-16-17(11-14)25-13-24-16/h2-8,11H,9-10,12-13H2,1H3 |
| InChIKey | PAWQQNGFUWHNBI-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 58.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.45 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|